C15H29N5O2S — CID 110047540
N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide (PubChem CID 110047540) has the molecular formula C15H29N5O2S and a molecular weight of 343.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110047540 |
| Molecular Formula | C15H29N5O2S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide |
| SMILES | CCC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCCSC)C1 |
| InChI | InChI=1S/C15H29N5O2S/c1-5-13(21)20-8-6-12(11-20)18-15(16-7-9-23-4)17-10-14(22)19(2)3/h12H,5-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | KFCDTTWMWPLVTR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|