C20H32FN5OS — CID 110041238
2-[[[[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110041238) has the molecular formula C20H32FN5OS and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-[[[[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110041238 |
| Molecular Formula | C20H32FN5OS |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-[[[[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NC1CCCN(c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C20H32FN5OS/c1-15-12-16(21)7-8-18(15)26-10-5-6-17(14-26)24-20(22-9-11-28-4)23-13-19(27)25(2)3/h7-8,12,17H,5-6,9-11,13-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | BZRKWCZILHOZCQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|