C22H30FN5OS — CID 110041282
2-[[[[1-(3-fluorophenyl)piperidin-3-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110041282) has the molecular formula C22H30FN5OS and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-[[[[1-(3-fluorophenyl)piperidin-3-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(3-fluorophenyl)piperidin-3-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110041282 |
| Molecular Formula | C22H30FN5OS |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[[[[1-(3-fluorophenyl)piperidin-3-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)NC1CCCN(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C22H30FN5OS/c1-27(2)21(29)15-25-22(24-11-10-20-9-5-13-30-20)26-18-7-4-12-28(16-18)19-8-3-6-17(23)14-19/h3,5-6,8-9,13-14,18H,4,7,10-12,15-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | LWMRXIMOLGWZIT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|