C20H32N4O2S — CID 110048374
N,N-dimethyl-2-[[(6-oxaspiro[4.5]decan-9-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide (PubChem CID 110048374) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(6-oxaspiro[4.5]decan-9-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(6-oxaspiro[4.5]decan-9-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110048374 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N,N-dimethyl-2-[[(6-oxaspiro[4.5]decan-9-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)NC1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C20H32N4O2S/c1-24(2)18(25)15-22-19(21-11-7-17-6-5-13-27-17)23-16-8-12-26-20(14-16)9-3-4-10-20/h5-6,13,16H,3-4,7-12,14-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZSVBIISAPJIUHF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|