C24H33IN4O2S — CID 110047927
N,N-dimethyl-2-[[(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110047927) has the molecular formula C24H33IN4O2S and a molecular weight of 568.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110047927 |
| Molecular Formula | C24H33IN4O2S |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | N,N-dimethyl-2-[[(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ylamino)-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)NC1CC2(CCCC2)Oc2ccccc21.I |
| InChI | InChI=1S/C24H32N4O2S.HI/c1-28(2)22(29)17-26-23(25-14-11-18-8-7-15-31-18)27-20-16-24(12-5-6-13-24)30-21-10-4-3-9-19(20)21;/h3-4,7-10,15,20H,5-6,11-14,16-17H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | GBTWRFXBHSDIFZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|