C20H33IN4O3S — CID 110040152
ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide (PubChem CID 110040152) has the molecular formula C20H33IN4O3S and a molecular weight of 536.48 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110040152 |
| Molecular Formula | C20H33IN4O3S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCC(N/C(=N/CC(=O)N(C)C)NCCc2cccs2)CC1.I |
| InChI | InChI=1S/C20H32N4O3S.HI/c1-4-27-19(26)15-7-9-16(10-8-15)23-20(22-14-18(25)24(2)3)21-12-11-17-6-5-13-28-17;/h5-6,13,15-16H,4,7-12,14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ITQDJTQNSZTWHF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|