C21H30IN5OS — CID 110041497
N,N-dimethyl-2-[[[(1-phenylpiperidin-3-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110041497) has the molecular formula C21H30IN5OS and a molecular weight of 527.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(1-phenylpiperidin-3-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(1-phenylpiperidin-3-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110041497 |
| Molecular Formula | C21H30IN5OS |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | N,N-dimethyl-2-[[[(1-phenylpiperidin-3-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)NC1CCCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C21H29N5OS.HI/c1-25(2)20(27)15-23-21(22-14-19-11-7-13-28-19)24-17-8-6-12-26(16-17)18-9-4-3-5-10-18;/h3-5,7,9-11,13,17H,6,8,12,14-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | YLZPIBHTFIFCGT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|