C18H31IN4OS2 — CID 110042577
2-[[[(3-ethylsulfanylcyclohexyl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110042577) has the molecular formula C18H31IN4OS2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-[[[(3-ethylsulfanylcyclohexyl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(3-ethylsulfanylcyclohexyl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110042577 |
| Molecular Formula | C18H31IN4OS2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[[[(3-ethylsulfanylcyclohexyl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCSC1CCCC(N/C(=N/CC(=O)N(C)C)NCc2cccs2)C1.I |
| InChI | InChI=1S/C18H30N4OS2.HI/c1-4-24-15-8-5-7-14(11-15)21-18(20-13-17(23)22(2)3)19-12-16-9-6-10-25-16;/h6,9-10,14-15H,4-5,7-8,11-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | NULZPAWCLVDBFF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|