C15H25IN4OS2 — CID 110042640
N,N-dimethyl-2-[[(thian-3-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110042640) has the molecular formula C15H25IN4OS2 and a molecular weight of 468.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(thian-3-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(thian-3-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110042640 |
| Molecular Formula | C15H25IN4OS2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N,N-dimethyl-2-[[(thian-3-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)NC1CCCSC1.I |
| InChI | InChI=1S/C15H24N4OS2.HI/c1-19(2)14(20)10-17-15(16-9-13-6-4-8-22-13)18-12-5-3-7-21-11-12;/h4,6,8,12H,3,5,7,9-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | LAULTJZMUFSAOM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|