C17H27N5O2S — CID 119133403
2-[[[(1-acetylpiperidin-4-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 119133403) has the molecular formula C17H27N5O2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-[[[(1-acetylpiperidin-4-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(1-acetylpiperidin-4-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 119133403 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[[[(1-acetylpiperidin-4-yl)amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCc2cccs2)CC1 |
| InChI | InChI=1S/C17H27N5O2S/c1-13(23)22-8-6-14(7-9-22)20-17(19-12-16(24)21(2)3)18-11-15-5-4-10-25-15/h4-5,10,14H,6-9,11-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | NNPLDFRITOYZDT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|