C18H30IN5O2S — CID 119133316
2-[[[(1-acetylpiperidin-4-yl)amino]-(1-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 119133316) has the molecular formula C18H30IN5O2S and a molecular weight of 507.44 g/mol. Its IUPAC name is 2-[[[(1-acetylpiperidin-4-yl)amino]-(1-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1-acetylpiperidin-4-yl)amino]-(1-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119133316 |
| Molecular Formula | C18H30IN5O2S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-[[[(1-acetylpiperidin-4-yl)amino]-(1-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NC(C)c2cccs2)CC1.I |
| InChI | InChI=1S/C18H29N5O2S.HI/c1-13(16-6-5-11-26-16)20-18(19-12-17(25)22(3)4)21-15-7-9-23(10-8-15)14(2)24;/h5-6,11,13,15H,7-10,12H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | BWFBGIQRBKQTTH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|