C18H28ClN5O — CID 110049692
2-[[[[1-(4-chlorophenyl)pyrrolidin-3-yl]amino]-(propylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110049692) has the molecular formula C18H28ClN5O and a molecular weight of 365.91 g/mol. Its IUPAC name is 2-[[[[1-(4-chlorophenyl)pyrrolidin-3-yl]amino]-(propylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(4-chlorophenyl)pyrrolidin-3-yl]amino]-(propylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110049692 |
| Molecular Formula | C18H28ClN5O |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[[[[1-(4-chlorophenyl)pyrrolidin-3-yl]amino]-(propylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NC1CCN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H28ClN5O/c1-4-10-20-18(21-12-17(25)23(2)3)22-15-9-11-24(13-15)16-7-5-14(19)6-8-16/h5-8,15H,4,9-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | QFNFGQNBIQKEIJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|