C20H29ClFN5O — CID 110049336
2-[[[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-(cyclopentylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110049336) has the molecular formula C20H29ClFN5O and a molecular weight of 409.94 g/mol. Its IUPAC name is 2-[[[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-(cyclopentylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-(cyclopentylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110049336 |
| Molecular Formula | C20H29ClFN5O |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[[[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-(cyclopentylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NC1CCCC1)NC1CCN(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C20H29ClFN5O/c1-26(2)19(28)12-23-20(24-14-5-3-4-6-14)25-15-9-10-27(13-15)16-7-8-17(21)18(22)11-16/h7-8,11,14-15H,3-6,9-10,12-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | ZTJWHOHDXUADMH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|