C22H35ClN6O — CID 110043259
2-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110043259) has the molecular formula C22H35ClN6O and a molecular weight of 435.02 g/mol. Its IUPAC name is 2-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110043259 |
| Molecular Formula | C22H35ClN6O |
| Molecular Weight | 435.02 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN1CCCC1CN/C(=N\CC(=O)N(C)C)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H35ClN6O/c1-4-28-11-6-9-20(28)14-24-22(25-15-21(30)27(2)3)26-18-10-12-29(16-18)19-8-5-7-17(23)13-19/h5,7-8,13,18,20H,4,6,9-12,14-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | HMHZYCVEHSOFSK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.02 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|