C20H32ClN5O — CID 111842536
2-[[[2-(2-chlorophenyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111842536) has the molecular formula C20H32ClN5O and a molecular weight of 393.96 g/mol. Its IUPAC name is 2-[[[2-(2-chlorophenyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(2-chlorophenyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111842536 |
| Molecular Formula | C20H32ClN5O |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-[[[2-(2-chlorophenyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN1CCCC1CN/C(=N\CC(=O)N(C)C)NCCc1ccccc1Cl |
| InChI | InChI=1S/C20H32ClN5O/c1-4-26-13-7-9-17(26)14-23-20(24-15-19(27)25(2)3)22-12-11-16-8-5-6-10-18(16)21/h5-6,8,10,17H,4,7,9,11-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | SVDOKZNDKCEIBQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|