C21H35N5OS — CID 111980111
2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-(2-phenylsulfanylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111980111) has the molecular formula C21H35N5OS and a molecular weight of 405.61 g/mol. Its IUPAC name is 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-(2-phenylsulfanylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-(2-phenylsulfanylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111980111 |
| Molecular Formula | C21H35N5OS |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-(2-phenylsulfanylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN1CCCC1CN/C(=N\CC(=O)N(C)C)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C21H35N5OS/c1-5-26-13-9-10-18(26)15-23-21(24-16-20(27)25(3)4)22-14-17(2)28-19-11-7-6-8-12-19/h6-8,11-12,17-18H,5,9-10,13-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | PDBHIOCAJHCZCM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|