C19H35IN6OS — CID 110034816
2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[2-(5-methyl-1,3-thiazol-2-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034816) has the molecular formula C19H35IN6OS and a molecular weight of 522.50 g/mol. Its IUPAC name is 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[2-(5-methyl-1,3-thiazol-2-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[2-(5-methyl-1,3-thiazol-2-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034816 |
| Molecular Formula | C19H35IN6OS |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[2-(5-methyl-1,3-thiazol-2-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N/CC(=O)N(C)C)NCC(C)c1ncc(C)s1.I |
| InChI | InChI=1S/C19H34N6OS.HI/c1-6-25-9-7-8-16(25)12-22-19(23-13-17(26)24(4)5)21-10-14(2)18-20-11-15(3)27-18;/h11,14,16H,6-10,12-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | QBKIDHAZKWQIJF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|