C19H32ClIN6O — CID 110033496
2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110033496) has the molecular formula C19H32ClIN6O and a molecular weight of 522.86 g/mol. Its IUPAC name is 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110033496 |
| Molecular Formula | C19H32ClIN6O |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\CC(=O)N(C)C)NCCc1ccc(Cl)nc1.I |
| InChI | InChI=1S/C19H31ClN6O.HI/c1-4-26-11-5-6-16(26)13-23-19(24-14-18(27)25(2)3)21-10-9-15-7-8-17(20)22-12-15;/h7-8,12,16H,4-6,9-11,13-14H2,1-3H3,(H2,21,23,24);1H |
| InChIKey | SWGJKEQKZSOHKB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|