C17H27ClIN5O2 — CID 110036416
2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110036416) has the molecular formula C17H27ClIN5O2 and a molecular weight of 495.79 g/mol. Its IUPAC name is 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110036416 |
| Molecular Formula | C17H27ClIN5O2 |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCc1ccc(Cl)nc1)NCC1CCCO1.I |
| InChI | InChI=1S/C17H26ClN5O2.HI/c1-23(2)16(24)12-22-17(21-11-14-4-3-9-25-14)19-8-7-13-5-6-15(18)20-10-13;/h5-6,10,14H,3-4,7-9,11-12H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | RVKWZBQVTXDBSS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|