C20H27ClIN5O — CID 110035462
2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035462) has the molecular formula C20H27ClIN5O and a molecular weight of 515.83 g/mol. Its IUPAC name is 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035462 |
| Molecular Formula | C20H27ClIN5O |
| Molecular Weight | 515.83 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccccc1)NCCc1ccc(Cl)nc1.I |
| InChI | InChI=1S/C20H26ClN5O.HI/c1-26(2)19(27)15-25-20(22-12-10-16-6-4-3-5-7-16)23-13-11-17-8-9-18(21)24-14-17;/h3-9,14H,10-13,15H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | UXSRYKBZXZLXQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|