C17H28ClN5O2 — CID 110033973
2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110033973) has the molecular formula C17H28ClN5O2 and a molecular weight of 369.90 g/mol. Its IUPAC name is 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110033973 |
| Molecular Formula | C17H28ClN5O2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[[[2-(6-chloro-3-pyridinyl)ethylamino]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)NCCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H28ClN5O2/c1-4-25-11-5-9-19-17(22-13-16(24)23(2)3)20-10-8-14-6-7-15(18)21-12-14/h6-7,12H,4-5,8-11,13H2,1-3H3,(H2,19,20,22) |
| InChIKey | IDPYRDPOIPUUSS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|