C19H27ClN4O2 — CID 110050816
1-[2-(6-chloro-3-pyridinyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 110050816) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 1-[2-(6-chloro-3-pyridinyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 1-[2-(6-chloro-3-pyridinyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110050816 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[2-(6-chloro-3-pyridinyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | CCOCCC/N=C(/NCCc1ccc(Cl)nc1)NCCc1ccco1 |
| InChI | InChI=1S/C19H27ClN4O2/c1-2-25-13-4-10-21-19(23-12-9-17-5-3-14-26-17)22-11-8-16-6-7-18(20)24-15-16/h3,5-7,14-15H,2,4,8-13H2,1H3,(H2,21,22,23) |
| InChIKey | IQLMHNWBWVATLV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|