C22H26ClIN4O — CID 110051551
1-[2-(6-chloro-3-pyridinyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 110051551) has the molecular formula C22H26ClIN4O and a molecular weight of 524.83 g/mol. Its IUPAC name is 1-[2-(6-chloro-3-pyridinyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(6-chloro-3-pyridinyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110051551 |
| Molecular Formula | C22H26ClIN4O |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 1-[2-(6-chloro-3-pyridinyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | Clc1ccc(CCN/C(=N/CCc2ccco2)NCCc2ccccc2)cn1.I |
| InChI | InChI=1S/C22H25ClN4O.HI/c23-21-9-8-19(17-27-21)11-14-25-22(26-15-12-20-7-4-16-28-20)24-13-10-18-5-2-1-3-6-18;/h1-9,16-17H,10-15H2,(H2,24,25,26);1H |
| InChIKey | HSGJCTNRJZUGEF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|