C23H32IN5O — CID 111541779
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111541779) has the molecular formula C23H32IN5O and a molecular weight of 521.45 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111541779 |
| Molecular Formula | C23H32IN5O |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(furan-2-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | Cc1cc(C)n(CCC/N=C(/NCCc2ccccc2)NCCc2ccco2)n1.I |
| InChI | InChI=1S/C23H31N5O.HI/c1-19-18-20(2)28(27-19)16-7-13-24-23(26-15-12-22-10-6-17-29-22)25-14-11-21-8-4-3-5-9-21;/h3-6,8-10,17-18H,7,11-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | IXJXISIFRMRWQF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|