C17H27N5O2 — CID 111139967
N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-(2-pyridin-2-ylethylamino)methylidene]amino]acetamide (PubChem CID 111139967) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-(2-pyridin-2-ylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-(2-pyridin-2-ylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111139967 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-(2-pyridin-2-ylethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCc1ccccn1)NCC1CCCO1 |
| InChI | InChI=1S/C17H27N5O2/c1-22(2)16(23)13-21-17(20-12-15-7-5-11-24-15)19-10-8-14-6-3-4-9-18-14/h3-4,6,9,15H,5,7-8,10-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | PIXRNKFINWKTHK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|