C22H38N6O — CID 111262691
2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111262691) has the molecular formula C22H38N6O and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111262691 |
| Molecular Formula | C22H38N6O |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 2-[[[(1-ethylpyrrolidin-2-yl)methylamino]-[3-(N-methylanilino)propylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN1CCCC1CN/C(=N\CC(=O)N(C)C)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C22H38N6O/c1-5-28-16-9-13-20(28)17-24-22(25-18-21(29)26(2)3)23-14-10-15-27(4)19-11-7-6-8-12-19/h6-8,11-12,20H,5,9-10,13-18H2,1-4H3,(H2,23,24,25) |
| InChIKey | HNPNIXPLROMJMF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|