C17H29N5O2S — CID 110035321
N,N-dimethyl-2-[[[2-(5-methyl-1,3-thiazol-2-yl)propylamino]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110035321) has the molecular formula C17H29N5O2S and a molecular weight of 367.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[2-(5-methyl-1,3-thiazol-2-yl)propylamino]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[2-(5-methyl-1,3-thiazol-2-yl)propylamino]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110035321 |
| Molecular Formula | C17H29N5O2S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N,N-dimethyl-2-[[[2-(5-methyl-1,3-thiazol-2-yl)propylamino]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide |
| SMILES | Cc1cnc(C(C)CN/C(=N/CC(=O)N(C)C)NCC2CCOC2)s1 |
| InChI | InChI=1S/C17H29N5O2S/c1-12(16-18-8-13(2)25-16)7-19-17(21-10-15(23)22(3)4)20-9-14-5-6-24-11-14/h8,12,14H,5-7,9-11H2,1-4H3,(H2,19,20,21) |
| InChIKey | DHHMOJGDYWBQFO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|