C16H23ClN2O2 — CID 6735969
2-(2-chlorophenyl)ethyl N-[(1-ethylpyrrolidin-2-yl)methyl]carbamate (PubChem CID 6735969) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl N-[(1-ethylpyrrolidin-2-yl)methyl]carbamate.
| Compound Name | 2-(2-chlorophenyl)ethyl N-[(1-ethylpyrrolidin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 6735969 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl N-[(1-ethylpyrrolidin-2-yl)methyl]carbamate |
| SMILES | CCN1CCCC1CNC(=O)OCCc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O2/c1-2-19-10-5-7-14(19)12-18-16(20)21-11-9-13-6-3-4-8-15(13)17/h3-4,6,8,14H,2,5,7,9-12H2,1H3,(H,18,20) |
| InChIKey | VLXCPRKLAIGGON-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |