C14H16ClFN2O3 — CID 122066406
3-[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid (PubChem CID 122066406) has the molecular formula C14H16ClFN2O3 and a molecular weight of 314.74 g/mol. Its IUPAC name is 3-[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066406 |
| Molecular Formula | C14H16ClFN2O3 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-[[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NC1CCN(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C14H16ClFN2O3/c1-8(14(20)21)13(19)17-9-4-5-18(7-9)10-2-3-11(15)12(16)6-10/h2-3,6,8-9H,4-5,7H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | UKRWJPWYSXAZHP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|