C16H23ClFN3O2 — CID 110012736
1-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-(5-hydroxypentan-2-yl)urea (PubChem CID 110012736) has the molecular formula C16H23ClFN3O2 and a molecular weight of 343.83 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-(5-hydroxypentan-2-yl)urea.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-(5-hydroxypentan-2-yl)urea |
|---|---|
| PubChem CID | 110012736 |
| Molecular Formula | C16H23ClFN3O2 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-(5-hydroxypentan-2-yl)urea |
| SMILES | CC(CCCO)NC(=O)NC1CCN(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H23ClFN3O2/c1-11(3-2-8-22)19-16(23)20-12-6-7-21(10-12)13-4-5-15(18)14(17)9-13/h4-5,9,11-12,22H,2-3,6-8,10H2,1H3,(H2,19,20,23) |
| InChIKey | KKLZAZQTPGOXSE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |