C14H17Cl2N3O3 — CID 122009296
3-[[1-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamoylamino]propanoic acid (PubChem CID 122009296) has the molecular formula C14H17Cl2N3O3 and a molecular weight of 346.21 g/mol. Its IUPAC name is 3-[[1-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[1-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122009296 |
| Molecular Formula | C14H17Cl2N3O3 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-[[1-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NC1CCN(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2N3O3/c15-11-2-1-10(7-12(11)16)19-6-4-9(8-19)18-14(22)17-5-3-13(20)21/h1-2,7,9H,3-6,8H2,(H,20,21)(H2,17,18,22) |
| InChIKey | UCIOIHUXJHEDMG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |