C15H20ClN3O3 — CID 122009161
4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoylamino]butanoic acid (PubChem CID 122009161) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122009161 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NC1CCN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H20ClN3O3/c16-11-3-5-13(6-4-11)19-9-7-12(10-19)18-15(22)17-8-1-2-14(20)21/h3-6,12H,1-2,7-10H2,(H,20,21)(H2,17,18,22) |
| InChIKey | AFVVLECNWLXCTR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|