C11H14ClFN2OS — CID 161148090
(3S)-1-(4-chloro-3-fluorophenyl)pyrrolidine-3-carboxamide;sulfane (PubChem CID 161148090) has the molecular formula C11H14ClFN2OS and a molecular weight of 276.76 g/mol. Its IUPAC name is (3S)-1-(4-chloro-3-fluorophenyl)pyrrolidine-3-carboxamide;sulfane.
| Compound Name | (3S)-1-(4-chloro-3-fluorophenyl)pyrrolidine-3-carboxamide;sulfane |
|---|---|
| PubChem CID | 161148090 |
| Molecular Formula | C11H14ClFN2OS |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | (3S)-1-(4-chloro-3-fluorophenyl)pyrrolidine-3-carboxamide;sulfane |
| SMILES | NC(=O)[C@H]1CCN(c2ccc(Cl)c(F)c2)C1.S |
| InChI | InChI=1S/C11H12ClFN2O.H2S/c12-9-2-1-8(5-10(9)13)15-4-3-7(6-15)11(14)16;/h1-2,5,7H,3-4,6H2,(H2,14,16);1H2/t7-;/m0./s1 |
| InChIKey | UOHWVIDRLAQHAI-FJXQXJEOSA-N |
| XLogP | 1.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |