C13H18N2O — CID 117008157
1-(4-ethylphenyl)pyrrolidine-3-carboxamide (PubChem CID 117008157) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(4-ethylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 117008157 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(4-ethylphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2CCC(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-2-10-3-5-12(6-4-10)15-8-7-11(9-15)13(14)16/h3-6,11H,2,7-9H2,1H3,(H2,14,16) |
| InChIKey | UZZFUXIOLCUGPA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|