C17H21N5O — CID 94173719
(3R)-1-[4-[(pyrimidin-2-ylamino)methyl]phenyl]piperidine-3-carboxamide (PubChem CID 94173719) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is (3R)-1-[4-[(pyrimidin-2-ylamino)methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[4-[(pyrimidin-2-ylamino)methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94173719 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3R)-1-[4-[(pyrimidin-2-ylamino)methyl]phenyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(c2ccc(CNc3ncccn3)cc2)C1 |
| InChI | InChI=1S/C17H21N5O/c18-16(23)14-3-1-10-22(12-14)15-6-4-13(5-7-15)11-21-17-19-8-2-9-20-17/h2,4-9,14H,1,3,10-12H2,(H2,18,23)(H,19,20,21)/t14-/m1/s1 |
| InChIKey | ZCAIBHOXIIYFTM-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|