C17H20ClN5O — CID 97220549
(3S)-1-[2-[[(5-chloropyrimidin-2-yl)amino]methyl]phenyl]piperidine-3-carboxamide (PubChem CID 97220549) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is (3S)-1-[2-[[(5-chloropyrimidin-2-yl)amino]methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-[[(5-chloropyrimidin-2-yl)amino]methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97220549 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (3S)-1-[2-[[(5-chloropyrimidin-2-yl)amino]methyl]phenyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN(c2ccccc2CNc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C17H20ClN5O/c18-14-9-21-17(22-10-14)20-8-12-4-1-2-6-15(12)23-7-3-5-13(11-23)16(19)24/h1-2,4,6,9-10,13H,3,5,7-8,11H2,(H2,19,24)(H,20,21,22)/t13-/m0/s1 |
| InChIKey | VWFPVGGPDYVCCG-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |