C20H23FN4O2 — CID 47062453
1-[4-[[(4-fluorophenyl)carbamoylamino]methyl]phenyl]piperidine-3-carboxamide (PubChem CID 47062453) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[4-[[(4-fluorophenyl)carbamoylamino]methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[4-[[(4-fluorophenyl)carbamoylamino]methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47062453 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[4-[[(4-fluorophenyl)carbamoylamino]methyl]phenyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ccc(CNC(=O)Nc3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C20H23FN4O2/c21-16-5-7-17(8-6-16)24-20(27)23-12-14-3-9-18(10-4-14)25-11-1-2-15(13-25)19(22)26/h3-10,15H,1-2,11-13H2,(H2,22,26)(H2,23,24,27) |
| InChIKey | LEIOXUNFQPMXKV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|