C20H25N3O — CID 56923040
1-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-3-phenylurea (PubChem CID 56923040) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-3-phenylurea.
| Compound Name | 1-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 56923040 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-3-phenylurea |
| SMILES | CC1CCCN(c2ccc(CNC(=O)Nc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H25N3O/c1-16-6-5-13-23(15-16)19-11-9-17(10-12-19)14-21-20(24)22-18-7-3-2-4-8-18/h2-4,7-12,16H,5-6,13-15H2,1H3,(H2,21,22,24) |
| InChIKey | QGMUAKWQFDWRQS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|