C19H24N2O2S — CID 53278603
N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 53278603) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53278603 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | CC1CCCN(c2ccc(CNS(=O)(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C19H24N2O2S/c1-16-6-5-13-21(15-16)18-11-9-17(10-12-18)14-20-24(22,23)19-7-3-2-4-8-19/h2-4,7-12,16,20H,5-6,13-15H2,1H3 |
| InChIKey | PIYSVBZGTIEGFK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|