C21H23N5O2 — CID 170858740
N-[[4-(3-carbamoylpiperidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide (PubChem CID 170858740) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[[4-(3-carbamoylpiperidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[[4-(3-carbamoylpiperidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 170858740 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[[4-(3-carbamoylpiperidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ccc(CNC(=O)c3n[nH]c4ccccc34)cc2)C1 |
| InChI | InChI=1S/C21H23N5O2/c22-20(27)15-4-3-11-26(13-15)16-9-7-14(8-10-16)12-23-21(28)19-17-5-1-2-6-18(17)24-25-19/h1-2,5-10,15H,3-4,11-13H2,(H2,22,27)(H,23,28)(H,24,25) |
| InChIKey | PNLZFTYBPOLKBZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|