C17H18ClN5OS — CID 94526893
(3S)-1-[4-[[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]methyl]phenyl]piperidine-3-carboxamide (PubChem CID 94526893) has the molecular formula C17H18ClN5OS and a molecular weight of 375.89 g/mol. Its IUPAC name is (3S)-1-[4-[[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[4-[[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94526893 |
| Molecular Formula | C17H18ClN5OS |
| Molecular Weight | 375.89 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (3S)-1-[4-[[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]methyl]phenyl]piperidine-3-carboxamide |
| SMILES | N#Cc1c(Cl)nsc1NCc1ccc(N2CCC[C@H](C(N)=O)C2)cc1 |
| InChI | InChI=1S/C17H18ClN5OS/c18-15-14(8-19)17(25-22-15)21-9-11-3-5-13(6-4-11)23-7-1-2-12(10-23)16(20)24/h3-6,12,21H,1-2,7,9-10H2,(H2,20,24)/t12-/m0/s1 |
| InChIKey | LDNQUGWNSKERJT-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|