C12H12Cl2FNO — CID 148838522
2-[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]acetyl chloride (PubChem CID 148838522) has the molecular formula C12H12Cl2FNO and a molecular weight of 276.14 g/mol. Its IUPAC name is 2-[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]acetyl chloride.
| Compound Name | 2-[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]acetyl chloride |
|---|---|
| PubChem CID | 148838522 |
| Molecular Formula | C12H12Cl2FNO |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-[1-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]acetyl chloride |
| SMILES | O=C(Cl)CC1CCN(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C12H12Cl2FNO/c13-10-2-1-9(6-11(10)15)16-4-3-8(7-16)5-12(14)17/h1-2,6,8H,3-5,7H2 |
| InChIKey | OVBJKVIPYDOFTN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|