C19H21ClFN3O — CID 67002034
1-(3-chloro-2-methylphenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea (PubChem CID 67002034) has the molecular formula C19H21ClFN3O and a molecular weight of 361.85 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 67002034 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(N2CC[C@@H](NC(=O)Nc3cccc(Cl)c3C)C2)cc1F |
| InChI | InChI=1S/C19H21ClFN3O/c1-12-6-7-15(10-17(12)21)24-9-8-14(11-24)22-19(25)23-18-5-3-4-16(20)13(18)2/h3-7,10,14H,8-9,11H2,1-2H3,(H2,22,23,25)/t14-/m1/s1 |
| InChIKey | VIGMAJBZKTWVAM-CQSZACIVSA-N |
| XLogP | 4.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |