C18H17Cl2N3O2 — CID 43970493
1-(3-chloro-2-methylphenyl)-3-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 43970493) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 43970493 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)NC1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-11-15(20)3-2-4-16(11)22-18(25)21-13-9-17(24)23(10-13)14-7-5-12(19)6-8-14/h2-8,13H,9-10H2,1H3,(H2,21,22,25) |
| InChIKey | LHTLALMMBXYEDX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |