C17H15ClFN3O2 — CID 7215893
1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-fluorophenyl)urea (PubChem CID 7215893) has the molecular formula C17H15ClFN3O2 and a molecular weight of 347.78 g/mol. Its IUPAC name is 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 7215893 |
| Molecular Formula | C17H15ClFN3O2 |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccccc1F)N[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H15ClFN3O2/c18-11-5-7-13(8-6-11)22-10-12(9-16(22)23)20-17(24)21-15-4-2-1-3-14(15)19/h1-8,12H,9-10H2,(H2,20,21,24)/t12-/m0/s1 |
| InChIKey | CDKIWZDGHHJRLI-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |