C18H19BrFN3O — CID 10222094
1-(2-bromophenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea (PubChem CID 10222094) has the molecular formula C18H19BrFN3O and a molecular weight of 392.27 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 10222094 |
| Molecular Formula | C18H19BrFN3O |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 1-(2-bromophenyl)-3-[(3R)-1-(3-fluoro-4-methylphenyl)pyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(N2CC[C@@H](NC(=O)Nc3ccccc3Br)C2)cc1F |
| InChI | InChI=1S/C18H19BrFN3O/c1-12-6-7-14(10-16(12)20)23-9-8-13(11-23)21-18(24)22-17-5-3-2-4-15(17)19/h2-7,10,13H,8-9,11H2,1H3,(H2,21,22,24)/t13-/m1/s1 |
| InChIKey | KTUAVJMNKVCKAO-CYBMUJFWSA-N |
| XLogP | 4.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |