C19H18ClFN2O2 — CID 42939717
N-(3-chloro-2-methylphenyl)-1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 42939717) has the molecular formula C19H18ClFN2O2 and a molecular weight of 360.82 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42939717 |
| Molecular Formula | C19H18ClFN2O2 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-1-(3-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)Nc3cccc(Cl)c3C)CC2=O)cc1F |
| InChI | InChI=1S/C19H18ClFN2O2/c1-11-6-7-14(9-16(11)21)23-10-13(8-18(23)24)19(25)22-17-5-3-4-15(20)12(17)2/h3-7,9,13H,8,10H2,1-2H3,(H,22,25) |
| InChIKey | HOBQGVLTMHHQIQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |