C18H16ClFN2O2 — CID 30845832
(3S)-N-(3-chloro-2-methylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 30845832) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is (3S)-N-(3-chloro-2-methylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(3-chloro-2-methylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 30845832 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (3S)-N-(3-chloro-2-methylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@H]1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C18H16ClFN2O2/c1-11-13(19)5-4-7-15(11)21-18(24)12-9-17(23)22(10-12)16-8-3-2-6-14(16)20/h2-8,12H,9-10H2,1H3,(H,21,24)/t12-/m0/s1 |
| InChIKey | WNHFQWVPBRLEGH-LBPRGKRZSA-N |
| XLogP | 3.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |