C19H16ClN3O2 — CID 9352106
(3R)-1-(3-chloro-4-methylphenyl)-N-(2-cyanophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 9352106) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-methylphenyl)-N-(2-cyanophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-chloro-4-methylphenyl)-N-(2-cyanophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9352106 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (3R)-1-(3-chloro-4-methylphenyl)-N-(2-cyanophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)Nc3ccccc3C#N)CC2=O)cc1Cl |
| InChI | InChI=1S/C19H16ClN3O2/c1-12-6-7-15(9-16(12)20)23-11-14(8-18(23)24)19(25)22-17-5-3-2-4-13(17)10-21/h2-7,9,14H,8,11H2,1H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | MNSFQXRZWKZAKF-CQSZACIVSA-N |
| XLogP | 3.51 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |