C18H13Cl2N3O2 — CID 113191100
N-(2-cyanophenyl)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 113191100) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113191100 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-(2-cyanophenyl)-1-(2,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CC(=O)N(c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C18H13Cl2N3O2/c19-13-5-6-14(20)16(8-13)23-10-12(7-17(23)24)18(25)22-15-4-2-1-3-11(15)9-21/h1-6,8,12H,7,10H2,(H,22,25) |
| InChIKey | KKAXSOWXSPFCKV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |